C29H35BrN4O5S — CID 162671641
4-[4,6-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrimidin-2-yl]oxybutyl carbamimidothioate;hydrobromide (PubChem CID 162671641) has the molecular formula C29H35BrN4O5S and a molecular weight of 631.59 g/mol. Its IUPAC name is 4-[4,6-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrimidin-2-yl]oxybutyl carbamimidothioate;hydrobromide.
| Compound Name | 4-[4,6-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrimidin-2-yl]oxybutyl carbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 162671641 |
| Molecular Formula | C29H35BrN4O5S |
| Molecular Weight | 631.59 g/mol |
| Exact Mass | 630.15 |
| IUPAC Name | 4-[4,6-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrimidin-2-yl]oxybutyl carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCCCCOc1nc(/C=C/c2ccc(OC)c(OC)c2)cc(/C=C/c2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C29H34N4O5S.BrH/c1-34-24-13-9-20(17-26(24)36-3)7-11-22-19-23(12-8-21-10-14-25(35-2)27(18-21)37-4)33-29(32-22)38-15-5-6-16-39-28(30)31;/h7-14,17-19H,5-6,15-16H2,1-4H3,(H3,30,31);1H/b11-7+,12-8+; |
| InChIKey | MPKVMQIBGMIKEY-GCHDFIKQSA-N |
| XLogP | 6.22 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|