C17H20ClN5O10P2 — CID 162671776
[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 162671776) has the molecular formula C17H20ClN5O10P2 and a molecular weight of 551.77 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 162671776 |
| Molecular Formula | C17H20ClN5O10P2 |
| Molecular Weight | 551.77 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H20ClN5O10P2/c18-17-21-14(19-6-9-4-2-1-3-5-9)11-15(22-17)23(8-20-11)16-13(25)12(24)10(32-16)7-31-35(29,30)33-34(26,27)28/h1-5,8,10,12-13,16,24-25H,6-7H2,(H,29,30)(H,19,21,22)(H2,26,27,28)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | VULCORDCMXIOCO-XNIJJKJLSA-N |
| XLogP | 0.94 |
| TPSA | 218.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.77 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|