C37H42N4O7 — CID 162671799
7,8-bis[3-(dimethylamino)propoxy]-17-hydroxy-12-(3-hydroxy-4-methoxyphenyl)-16-methoxy-1,4-diazapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one (PubChem CID 162671799) has the molecular formula C37H42N4O7 and a molecular weight of 654.76 g/mol. Its IUPAC name is 7,8-bis[3-(dimethylamino)propoxy]-17-hydroxy-12-(3-hydroxy-4-methoxyphenyl)-16-methoxy-1,4-diazapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one.
| Compound Name | 7,8-bis[3-(dimethylamino)propoxy]-17-hydroxy-12-(3-hydroxy-4-methoxyphenyl)-16-methoxy-1,4-diazapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 162671799 |
| Molecular Formula | C37H42N4O7 |
| Molecular Weight | 654.76 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | 7,8-bis[3-(dimethylamino)propoxy]-17-hydroxy-12-(3-hydroxy-4-methoxyphenyl)-16-methoxy-1,4-diazapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
| SMILES | COc1ccc(-c2c3c4cc(OCCCN(C)C)c(OCCCN(C)C)cc4[nH]c(=O)c3n3ccc4cc(O)c(OC)cc4c23)cc1O |
| InChI | InChI=1S/C37H42N4O7/c1-39(2)12-7-15-47-31-20-25-26(21-32(31)48-16-8-13-40(3)4)38-37(44)36-34(25)33(23-9-10-29(45-5)27(42)18-23)35-24-19-30(46-6)28(43)17-22(24)11-14-41(35)36/h9-11,14,17-21,42-43H,7-8,12-13,15-16H2,1-6H3,(H,38,44) |
| InChIKey | UYSMPOTUUGPRIT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.76 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|