About 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline
3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline (PubChem CID 162671975) has the molecular formula C30H32N2O3
and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline.
Molecular Properties
| Compound Name | 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline |
| PubChem CID | 162671975 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline |
| SMILES | COc1cc(Oc2cccc(Nc3ccccc3)c2)cc(OC)c1CNCCc1ccc(C)cc1 |
| InChI | InChI=1S/C30H32N2O3/c1-22-12-14-23(15-13-22)16-17-31-21-28-29(33-2)19-27(20-30(28)34-3)35-26-11-7-10-25(18-26)32-24-8-5-4-6-9-24/h4-15,18-20,31-32H,16-17,21H2,1-3H3 |
| InChIKey | XDRLWBYBNCKXSH-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline?
The IUPAC name of 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline (CID 162671975) is 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline.
What is the SMILES notation for 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline?
The canonical SMILES for 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline is COc1cc(Oc2cccc(Nc3ccccc3)c2)cc(OC)c1CNCCc1ccc(C)cc1.
What is the InChIKey of 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline?
The InChIKey is XDRLWBYBNCKXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32N2O3/c1-22-12-14-23(15-13-22)16-17-31-21-28-29(33-2)19-27(20-30(28)34-3)35-26-11-7-10-25(18-26)32-24-8-5-4-6-9-24/h4-15,18-20,31-32H,16-17,21H2,1-3H3.
What are the key properties of 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline?
3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline has a molecular weight of 468.60 g/mol, XLogP of 6.88, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dimethoxy-4-[[2-(4-methylphenyl)ethylamino]methyl]phenoxy]-N-phenylaniline is sourced from PubChem (CID 162671975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).