C18H15N3O4 — CID 162671986
3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 162671986) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 162671986 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2ccccn2)c(Nc2ccc3c(c2)OCCO3)c1=O |
| InChI | InChI=1S/C18H15N3O4/c22-17-15(20-10-12-3-1-2-6-19-12)16(18(17)23)21-11-4-5-13-14(9-11)25-8-7-24-13/h1-6,9,20-21H,7-8,10H2 |
| InChIKey | HVEOHEXEPXATBS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|