C17H15F4N5 — CID 162671999
N-(4,7-difluoro-2,3-dihydro-1H-inden-2-yl)-2-(1,1-difluoroethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 162671999) has the molecular formula C17H15F4N5 and a molecular weight of 365.33 g/mol. Its IUPAC name is N-(4,7-difluoro-2,3-dihydro-1H-inden-2-yl)-2-(1,1-difluoroethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(4,7-difluoro-2,3-dihydro-1H-inden-2-yl)-2-(1,1-difluoroethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 162671999 |
| Molecular Formula | C17H15F4N5 |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(4,7-difluoro-2,3-dihydro-1H-inden-2-yl)-2-(1,1-difluoroethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NC2Cc3c(F)ccc(F)c3C2)n2nc(C(C)(F)F)nc2n1 |
| InChI | InChI=1S/C17H15F4N5/c1-8-5-14(26-16(22-8)24-15(25-26)17(2,20)21)23-9-6-10-11(7-9)13(19)4-3-12(10)18/h3-5,9,23H,6-7H2,1-2H3 |
| InChIKey | RFLKNKXKLVKCAE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |