C14H8F5NO2 — CID 162672304
(Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-quinolin-3-ylpent-1-en-3-one (PubChem CID 162672304) has the molecular formula C14H8F5NO2 and a molecular weight of 317.21 g/mol. Its IUPAC name is (Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-quinolin-3-ylpent-1-en-3-one.
| Compound Name | (Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-quinolin-3-ylpent-1-en-3-one |
|---|---|
| PubChem CID | 162672304 |
| Molecular Formula | C14H8F5NO2 |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | (Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-quinolin-3-ylpent-1-en-3-one |
| SMILES | O=C(/C=C(\O)c1cnc2ccccc2c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H8F5NO2/c15-13(16,14(17,18)19)12(22)6-11(21)9-5-8-3-1-2-4-10(8)20-7-9/h1-7,21H/b11-6- |
| InChIKey | GPAPXURZEBKDGD-WDZFZDKYSA-N |
| XLogP | 3.90 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|