About ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate
ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate (PubChem CID 162672401) has the molecular formula C16H16N4O2S
and a molecular weight of 328.40 g/mol. Its IUPAC name is ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate |
| PubChem CID | 162672401 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2nccs2)nc1NCc1ccccc1 |
| InChI | InChI=1S/C16H16N4O2S/c1-2-22-15(21)13-11-20(16-17-8-9-23-16)19-14(13)18-10-12-6-4-3-5-7-12/h3-9,11H,2,10H2,1H3,(H,18,19) |
| InChIKey | JEPNGXACTQNEKW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate?
The IUPAC name of ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate (CID 162672401) is ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate?
The canonical SMILES for ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate is CCOC(=O)c1cn(-c2nccs2)nc1NCc1ccccc1.
What is the InChIKey of ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate?
The InChIKey is JEPNGXACTQNEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2S/c1-2-22-15(21)13-11-20(16-17-8-9-23-16)19-14(13)18-10-12-6-4-3-5-7-12/h3-9,11H,2,10H2,1H3,(H,18,19).
What are the key properties of ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate?
ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate has a molecular weight of 328.40 g/mol, XLogP of 3.12, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(benzylamino)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate is sourced from PubChem (CID 162672401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).