C15H18BrN5O3S — CID 162672413
7-bromo-3,6,6-trimethyl-4-oxo-1-[5-(sulfamoylamino)-2-pyridinyl]-5,7-dihydroindazole (PubChem CID 162672413) has the molecular formula C15H18BrN5O3S and a molecular weight of 428.31 g/mol. Its IUPAC name is 7-bromo-3,6,6-trimethyl-4-oxo-1-[5-(sulfamoylamino)-2-pyridinyl]-5,7-dihydroindazole.
| Compound Name | 7-bromo-3,6,6-trimethyl-4-oxo-1-[5-(sulfamoylamino)-2-pyridinyl]-5,7-dihydroindazole |
|---|---|
| PubChem CID | 162672413 |
| Molecular Formula | C15H18BrN5O3S |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 7-bromo-3,6,6-trimethyl-4-oxo-1-[5-(sulfamoylamino)-2-pyridinyl]-5,7-dihydroindazole |
| SMILES | Cc1nn(-c2ccc(NS(N)(=O)=O)cn2)c2c1C(=O)CC(C)(C)C2Br |
| InChI | InChI=1S/C15H18BrN5O3S/c1-8-12-10(22)6-15(2,3)14(16)13(12)21(19-8)11-5-4-9(7-18-11)20-25(17,23)24/h4-5,7,14,20H,6H2,1-3H3,(H2,17,23,24) |
| InChIKey | NSSAUSSRVBVSCA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|