About 4-(1,3-thiazol-2-yldisulfanyl)aniline
4-(1,3-thiazol-2-yldisulfanyl)aniline (PubChem CID 162672513) has the molecular formula C9H8N2S3
and a molecular weight of 240.38 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yldisulfanyl)aniline.
Molecular Properties
| Compound Name | 4-(1,3-thiazol-2-yldisulfanyl)aniline |
| PubChem CID | 162672513 |
| Molecular Formula | C9H8N2S3 |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 4-(1,3-thiazol-2-yldisulfanyl)aniline |
| SMILES | Nc1ccc(SSc2nccs2)cc1 |
| InChI | InChI=1S/C9H8N2S3/c10-7-1-3-8(4-2-7)13-14-9-11-5-6-12-9/h1-6H,10H2 |
| InChIKey | SEOCWEZOTVCXBR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-thiazol-2-yldisulfanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-thiazol-2-yldisulfanyl)aniline?
The IUPAC name of 4-(1,3-thiazol-2-yldisulfanyl)aniline (CID 162672513) is 4-(1,3-thiazol-2-yldisulfanyl)aniline.
What is the SMILES notation for 4-(1,3-thiazol-2-yldisulfanyl)aniline?
The canonical SMILES for 4-(1,3-thiazol-2-yldisulfanyl)aniline is Nc1ccc(SSc2nccs2)cc1.
What is the InChIKey of 4-(1,3-thiazol-2-yldisulfanyl)aniline?
The InChIKey is SEOCWEZOTVCXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2S3/c10-7-1-3-8(4-2-7)13-14-9-11-5-6-12-9/h1-6H,10H2.
What are the key properties of 4-(1,3-thiazol-2-yldisulfanyl)aniline?
4-(1,3-thiazol-2-yldisulfanyl)aniline has a molecular weight of 240.38 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-thiazol-2-yldisulfanyl)aniline is sourced from PubChem (CID 162672513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).