C29H31NO — CID 162672732
11-benzyl-8-tert-butyl-3,3,5-trimethylpyrano[3,2-a]carbazole (PubChem CID 162672732) has the molecular formula C29H31NO and a molecular weight of 409.57 g/mol. Its IUPAC name is 11-benzyl-8-tert-butyl-3,3,5-trimethylpyrano[3,2-a]carbazole.
| Compound Name | 11-benzyl-8-tert-butyl-3,3,5-trimethylpyrano[3,2-a]carbazole |
|---|---|
| PubChem CID | 162672732 |
| Molecular Formula | C29H31NO |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 11-benzyl-8-tert-butyl-3,3,5-trimethylpyrano[3,2-a]carbazole |
| SMILES | Cc1cc2c3cc(C(C)(C)C)ccc3n(Cc3ccccc3)c2c2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C29H31NO/c1-19-16-24-23-17-21(28(2,3)4)12-13-25(23)30(18-20-10-8-7-9-11-20)26(24)22-14-15-29(5,6)31-27(19)22/h7-17H,18H2,1-6H3 |
| InChIKey | VHWCZQNZTSXSAO-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |