About N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide
N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide (PubChem CID 162672738) has the molecular formula C25H30FN3O2
and a molecular weight of 423.53 g/mol. Its IUPAC name is N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide.
Molecular Properties
| Compound Name | N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide |
| PubChem CID | 162672738 |
| Molecular Formula | C25H30FN3O2 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(CCCN1CCC(c2noc3cc(F)ccc23)CC1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H30FN3O2/c1-18(2)29(25(30)20-7-4-3-5-8-20)14-6-13-28-15-11-19(12-16-28)24-22-10-9-21(26)17-23(22)31-27-24/h3-5,7-10,17-19H,6,11-16H2,1-2H3 |
| InChIKey | HYERVAPNBCDTON-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide?
The IUPAC name of N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide (CID 162672738) is N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide.
What is the SMILES notation for N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide?
The canonical SMILES for N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide is CC(C)N(CCCN1CCC(c2noc3cc(F)ccc23)CC1)C(=O)c1ccccc1.
What is the InChIKey of N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide?
The InChIKey is HYERVAPNBCDTON-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30FN3O2/c1-18(2)29(25(30)20-7-4-3-5-8-20)14-6-13-28-15-11-19(12-16-28)24-22-10-9-21(26)17-23(22)31-27-24/h3-5,7-10,17-19H,6,11-16H2,1-2H3.
What are the key properties of N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide?
N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide has a molecular weight of 423.53 g/mol, XLogP of 5.09, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-propan-2-ylbenzamide is sourced from PubChem (CID 162672738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).