C30H22N6O3 — CID 162672776
N-[3-[4-[4-[(1,3-dioxoisoindol-2-yl)methyl]anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide (PubChem CID 162672776) has the molecular formula C30H22N6O3 and a molecular weight of 514.55 g/mol. Its IUPAC name is N-[3-[4-[4-[(1,3-dioxoisoindol-2-yl)methyl]anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[4-[4-[(1,3-dioxoisoindol-2-yl)methyl]anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162672776 |
| Molecular Formula | C30H22N6O3 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | N-[3-[4-[4-[(1,3-dioxoisoindol-2-yl)methyl]anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2c[nH]c3ncnc(Nc4ccc(CN5C(=O)c6ccccc6C5=O)cc4)c23)c1 |
| InChI | InChI=1S/C30H22N6O3/c1-2-25(37)34-21-7-5-6-19(14-21)24-15-31-27-26(24)28(33-17-32-27)35-20-12-10-18(11-13-20)16-36-29(38)22-8-3-4-9-23(22)30(36)39/h2-15,17H,1,16H2,(H,34,37)(H2,31,32,33,35) |
| InChIKey | CBHNKMDPARMMCD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|