C39H45N3O6 — CID 162672924
methyl 3-[[[3,5-bis[[(3-methoxycarbonylphenyl)methylamino]methyl]-2,4,6-trimethylphenyl]methylamino]methyl]benzoate (PubChem CID 162672924) has the molecular formula C39H45N3O6 and a molecular weight of 651.80 g/mol. Its IUPAC name is methyl 3-[[[3,5-bis[[(3-methoxycarbonylphenyl)methylamino]methyl]-2,4,6-trimethylphenyl]methylamino]methyl]benzoate.
| Compound Name | methyl 3-[[[3,5-bis[[(3-methoxycarbonylphenyl)methylamino]methyl]-2,4,6-trimethylphenyl]methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 162672924 |
| Molecular Formula | C39H45N3O6 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | methyl 3-[[[3,5-bis[[(3-methoxycarbonylphenyl)methylamino]methyl]-2,4,6-trimethylphenyl]methylamino]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CNCc2c(C)c(CNCc3cccc(C(=O)OC)c3)c(C)c(CNCc3cccc(C(=O)OC)c3)c2C)c1 |
| InChI | InChI=1S/C39H45N3O6/c1-25-34(22-40-19-28-10-7-13-31(16-28)37(43)46-4)26(2)36(24-42-21-30-12-9-15-33(18-30)39(45)48-6)27(3)35(25)23-41-20-29-11-8-14-32(17-29)38(44)47-5/h7-18,40-42H,19-24H2,1-6H3 |
| InChIKey | GGRLRRAAPJLDLD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|