C17H16BrN3OS — CID 162672943
1-(1,3-benzothiazol-2-yl)-7-bromo-3,6,6-trimethyl-5,7-dihydroindazol-4-one (PubChem CID 162672943) has the molecular formula C17H16BrN3OS and a molecular weight of 390.31 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-7-bromo-3,6,6-trimethyl-5,7-dihydroindazol-4-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-7-bromo-3,6,6-trimethyl-5,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 162672943 |
| Molecular Formula | C17H16BrN3OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-7-bromo-3,6,6-trimethyl-5,7-dihydroindazol-4-one |
| SMILES | Cc1nn(-c2nc3ccccc3s2)c2c1C(=O)CC(C)(C)C2Br |
| InChI | InChI=1S/C17H16BrN3OS/c1-9-13-11(22)8-17(2,3)15(18)14(13)21(20-9)16-19-10-6-4-5-7-12(10)23-16/h4-7,15H,8H2,1-3H3 |
| InChIKey | YBUDPQRBMXRZMH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|