C20H15NO3 — CID 162672971
4-(4-methylphenyl)-3,4-dihydro-1H-benzo[h]quinoline-2,5,6-trione (PubChem CID 162672971) has the molecular formula C20H15NO3 and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3,4-dihydro-1H-benzo[h]quinoline-2,5,6-trione.
| Compound Name | 4-(4-methylphenyl)-3,4-dihydro-1H-benzo[h]quinoline-2,5,6-trione |
|---|---|
| PubChem CID | 162672971 |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-(4-methylphenyl)-3,4-dihydro-1H-benzo[h]quinoline-2,5,6-trione |
| SMILES | Cc1ccc(C2CC(=O)NC3=C2C(=O)C(=O)c2ccccc23)cc1 |
| InChI | InChI=1S/C20H15NO3/c1-11-6-8-12(9-7-11)15-10-16(22)21-18-13-4-2-3-5-14(13)19(23)20(24)17(15)18/h2-9,15H,10H2,1H3,(H,21,22) |
| InChIKey | VUYIZGCEMBAYAR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|