C36H44N8O4 — CID 162673145
N-[4-anilino-2-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrimidin-5-yl]-3,5-dimethoxybenzamide (PubChem CID 162673145) has the molecular formula C36H44N8O4 and a molecular weight of 652.80 g/mol. Its IUPAC name is N-[4-anilino-2-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrimidin-5-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[4-anilino-2-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrimidin-5-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 162673145 |
| Molecular Formula | C36H44N8O4 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | N-[4-anilino-2-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrimidin-5-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2cnc(Nc3ccc(N4CCC(N5CCN(C)CC5)CC4)c(OC)c3)nc2Nc2ccccc2)c1 |
| InChI | InChI=1S/C36H44N8O4/c1-42-16-18-43(19-17-42)28-12-14-44(15-13-28)32-11-10-27(22-33(32)48-4)39-36-37-24-31(34(41-36)38-26-8-6-5-7-9-26)40-35(45)25-20-29(46-2)23-30(21-25)47-3/h5-11,20-24,28H,12-19H2,1-4H3,(H,40,45)(H2,37,38,39,41) |
| InChIKey | IUPKQUZJLKTYOA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|