About 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine
2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine (PubChem CID 162673167) has the molecular formula C19H21NO4
and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine |
| PubChem CID | 162673167 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine |
| SMILES | CCOc1ccc(C2N=C2c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H21NO4/c1-5-24-14-8-6-12(7-9-14)17-18(20-17)13-10-15(21-2)19(23-4)16(11-13)22-3/h6-11,17H,5H2,1-4H3 |
| InChIKey | FAPKSDUUXCORQT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine?
The IUPAC name of 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine (CID 162673167) is 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine.
What is the SMILES notation for 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine?
The canonical SMILES for 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine is CCOc1ccc(C2N=C2c2cc(OC)c(OC)c(OC)c2)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine?
The InChIKey is FAPKSDUUXCORQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4/c1-5-24-14-8-6-12(7-9-14)17-18(20-17)13-10-15(21-2)19(23-4)16(11-13)22-3/h6-11,17H,5H2,1-4H3.
What are the key properties of 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine?
2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine has a molecular weight of 327.38 g/mol, XLogP of 3.66, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-2H-azirine is sourced from PubChem (CID 162673167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).