About [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate
[4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate (PubChem CID 162673173) has the molecular formula C28H29N3O4
and a molecular weight of 471.56 g/mol. Its IUPAC name is [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate.
Molecular Properties
| Compound Name | [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate |
| PubChem CID | 162673173 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate |
| SMILES | O=C(NO)c1ccc(COC(=O)N2CCC3(CC2)CN(Cc2ccccc2)c2ccccc23)cc1 |
| InChI | InChI=1S/C28H29N3O4/c32-26(29-34)23-12-10-22(11-13-23)19-35-27(33)30-16-14-28(15-17-30)20-31(18-21-6-2-1-3-7-21)25-9-5-4-8-24(25)28/h1-13,34H,14-20H2,(H,29,32) |
| InChIKey | KJFQCAJLBHHVPB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate?
The IUPAC name of [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate (CID 162673173) is [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate.
What is the SMILES notation for [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate?
The canonical SMILES for [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate is O=C(NO)c1ccc(COC(=O)N2CCC3(CC2)CN(Cc2ccccc2)c2ccccc23)cc1.
What is the InChIKey of [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate?
The InChIKey is KJFQCAJLBHHVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29N3O4/c32-26(29-34)23-12-10-22(11-13-23)19-35-27(33)30-16-14-28(15-17-30)20-31(18-21-6-2-1-3-7-21)25-9-5-4-8-24(25)28/h1-13,34H,14-20H2,(H,29,32).
What are the key properties of [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate?
[4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate has a molecular weight of 471.56 g/mol, XLogP of 4.50, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxycarbamoyl)phenyl]methyl 1-benzylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate is sourced from PubChem (CID 162673173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).