C34H20F3N7 — CID 162673333
5,10,15-tris(2-fluoro-4-pyridinyl)-22,23-dihydro-21H-corrin (PubChem CID 162673333) has the molecular formula C34H20F3N7 and a molecular weight of 583.58 g/mol. Its IUPAC name is 5,10,15-tris(2-fluoro-4-pyridinyl)-22,23-dihydro-21H-corrin.
| Compound Name | 5,10,15-tris(2-fluoro-4-pyridinyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 162673333 |
| Molecular Formula | C34H20F3N7 |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | 5,10,15-tris(2-fluoro-4-pyridinyl)-22,23-dihydro-21H-corrin |
| SMILES | Fc1cc(-c2c3nc(c4ccc([nH]4)c(-c4ccnc(F)c4)c4ccc([nH]4)c(-c4ccnc(F)c4)c4ccc2[nH]4)C=C3)ccn1 |
| InChI | InChI=1S/C34H20F3N7/c35-29-15-18(9-12-38-29)32-23-3-1-21(41-23)22-2-4-24(42-22)33(19-10-13-39-30(36)16-19)26-6-8-28(44-26)34(27-7-5-25(32)43-27)20-11-14-40-31(37)17-20/h1-17,41,43-44H/b22-21-,32-23-,32-25-,33-24-,33-26-,34-27-,34-28- |
| InChIKey | UEQUBSQCJAJNRH-BKFGIQNASA-N |
| XLogP | 8.30 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|