About 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine
11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine (PubChem CID 162673374) has the molecular formula C28H20BrN3O2S
and a molecular weight of 542.46 g/mol. Its IUPAC name is 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine.
Molecular Properties
| Compound Name | 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine |
| PubChem CID | 162673374 |
| Molecular Formula | C28H20BrN3O2S |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3c(nc4c(Br)ccnc4c3-c3ccccc3)-c3ccccc32)cc1 |
| InChI | InChI=1S/C28H20BrN3O2S/c1-18-11-13-20(14-12-18)35(33,34)32-17-22-25(19-7-3-2-4-8-19)28-27(23(29)15-16-30-28)31-26(22)21-9-5-6-10-24(21)32/h2-16H,17H2,1H3 |
| InChIKey | JATIRDZKIFYCTL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine?
The IUPAC name of 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine (CID 162673374) is 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine.
What is the SMILES notation for 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine?
The canonical SMILES for 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine is Cc1ccc(S(=O)(=O)N2Cc3c(nc4c(Br)ccnc4c3-c3ccccc3)-c3ccccc32)cc1.
What is the InChIKey of 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine?
The InChIKey is JATIRDZKIFYCTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20BrN3O2S/c1-18-11-13-20(14-12-18)35(33,34)32-17-22-25(19-7-3-2-4-8-19)28-27(23(29)15-16-30-28)31-26(22)21-9-5-6-10-24(21)32/h2-16H,17H2,1H3.
What are the key properties of 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine?
11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine has a molecular weight of 542.46 g/mol, XLogP of 6.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6H-quinolino[4,3-b][1,5]naphthyridine is sourced from PubChem (CID 162673374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).