C31H33NO3S2 — CID 162673380
(1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-yl) 5-(dithiolan-3-yl)pentanoate (PubChem CID 162673380) has the molecular formula C31H33NO3S2 and a molecular weight of 531.74 g/mol. Its IUPAC name is (1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-yl) 5-(dithiolan-3-yl)pentanoate.
| Compound Name | (1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-yl) 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 162673380 |
| Molecular Formula | C31H33NO3S2 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-yl) 5-(dithiolan-3-yl)pentanoate |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1c(ccc3ccc(OC(=O)CCCCC4CCSS4)cc13)O2 |
| InChI | InChI=1S/C31H33NO3S2/c1-30(2)26-9-5-6-10-27(26)32(3)31(30)18-16-24-25-20-22(14-12-21(25)13-15-28(24)35-31)34-29(33)11-7-4-8-23-17-19-36-37-23/h5-6,9-10,12-16,18,20,23H,4,7-8,11,17,19H2,1-3H3 |
| InChIKey | MHSIIKOSWHTPLR-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|