About 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide
2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide (PubChem CID 162673556) has the molecular formula C21H17F2N5O2
and a molecular weight of 409.40 g/mol. Its IUPAC name is 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide.
Molecular Properties
| Compound Name | 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide |
| PubChem CID | 162673556 |
| Molecular Formula | C21H17F2N5O2 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide |
| SMILES | C[C@H](Oc1cc2cc(C(N)=O)ccc2nc1N)c1cc(F)c(F)cc1-n1cccn1 |
| InChI | InChI=1S/C21H17F2N5O2/c1-11(14-9-15(22)16(23)10-18(14)28-6-2-5-26-28)30-19-8-13-7-12(21(25)29)3-4-17(13)27-20(19)24/h2-11H,1H3,(H2,24,27)(H2,25,29)/t11-/m0/s1 |
| InChIKey | OUICJZHIQAKXGL-NSHDSACASA-N |
| XLogP | 3.52 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide?
The IUPAC name of 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide (CID 162673556) is 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide.
What is the SMILES notation for 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide?
The canonical SMILES for 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide is C[C@H](Oc1cc2cc(C(N)=O)ccc2nc1N)c1cc(F)c(F)cc1-n1cccn1.
What is the InChIKey of 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide?
The InChIKey is OUICJZHIQAKXGL-NSHDSACASA-N. The full InChI is InChI=1S/C21H17F2N5O2/c1-11(14-9-15(22)16(23)10-18(14)28-6-2-5-26-28)30-19-8-13-7-12(21(25)29)3-4-17(13)27-20(19)24/h2-11H,1H3,(H2,24,27)(H2,25,29)/t11-/m0/s1.
What are the key properties of 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide?
2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide has a molecular weight of 409.40 g/mol, XLogP of 3.52, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(1S)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethoxy]quinoline-6-carboxamide is sourced from PubChem (CID 162673556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).