C17H19NO2 — CID 162673605
ethyl (2E,4E,6E,8E,10E)-11-(1H-pyrrol-2-yl)undeca-2,4,6,8,10-pentaenoate (PubChem CID 162673605) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E,10E)-11-(1H-pyrrol-2-yl)undeca-2,4,6,8,10-pentaenoate.
| Compound Name | ethyl (2E,4E,6E,8E,10E)-11-(1H-pyrrol-2-yl)undeca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 162673605 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethyl (2E,4E,6E,8E,10E)-11-(1H-pyrrol-2-yl)undeca-2,4,6,8,10-pentaenoate |
| SMILES | CCOC(=O)/C=C/C=C/C=C/C=C/C=C/c1ccc[nH]1 |
| InChI | InChI=1S/C17H19NO2/c1-2-20-17(19)14-10-8-6-4-3-5-7-9-12-16-13-11-15-18-16/h3-15,18H,2H2,1H3/b4-3+,7-5+,8-6+,12-9+,14-10+ |
| InChIKey | PTQSXPADXKBGPT-LTQWNSRPSA-N |
| XLogP | 3.82 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|