C28H28N8O4S — CID 162673744
N-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)phenyl]-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide (PubChem CID 162673744) has the molecular formula C28H28N8O4S and a molecular weight of 572.65 g/mol. Its IUPAC name is N-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)phenyl]-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide.
| Compound Name | N-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)phenyl]-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 162673744 |
| Molecular Formula | C28H28N8O4S |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | N-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)phenyl]-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide |
| SMILES | Nc1nc(-c2ccc(NC(=O)CCNCCc3ccc(S(N)(=O)=O)cc3)cc2)cn2c(=O)n(-c3ccccc3)nc12 |
| InChI | InChI=1S/C28H28N8O4S/c29-26-27-34-36(22-4-2-1-3-5-22)28(38)35(27)18-24(33-26)20-8-10-21(11-9-20)32-25(37)15-17-31-16-14-19-6-12-23(13-7-19)41(30,39)40/h1-13,18,31H,14-17H2,(H2,29,33)(H,32,37)(H2,30,39,40) |
| InChIKey | XXOMDNKNONGBRR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 179.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|