C24H24N6O7 — CID 162673815
N-[[4-[4-(5-methyl-2,4-dioxopyrimidin-1-yl)piperidin-1-yl]phenyl]methyl]-2,4-dinitrobenzamide (PubChem CID 162673815) has the molecular formula C24H24N6O7 and a molecular weight of 508.49 g/mol. Its IUPAC name is N-[[4-[4-(5-methyl-2,4-dioxopyrimidin-1-yl)piperidin-1-yl]phenyl]methyl]-2,4-dinitrobenzamide.
| Compound Name | N-[[4-[4-(5-methyl-2,4-dioxopyrimidin-1-yl)piperidin-1-yl]phenyl]methyl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 162673815 |
| Molecular Formula | C24H24N6O7 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | N-[[4-[4-(5-methyl-2,4-dioxopyrimidin-1-yl)piperidin-1-yl]phenyl]methyl]-2,4-dinitrobenzamide |
| SMILES | Cc1cn(C2CCN(c3ccc(CNC(=O)c4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc3)CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H24N6O7/c1-15-14-28(24(33)26-22(15)31)18-8-10-27(11-9-18)17-4-2-16(3-5-17)13-25-23(32)20-7-6-19(29(34)35)12-21(20)30(36)37/h2-7,12,14,18H,8-11,13H2,1H3,(H,25,32)(H,26,31,33) |
| InChIKey | OIDWVFLRZHPMHO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 173.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|