About 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole
3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole (PubChem CID 162673848) has the molecular formula C23H21NO3
and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole.
Molecular Properties
| Compound Name | 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole |
| PubChem CID | 162673848 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole |
| SMILES | COc1cc(-c2c[nH]cc2-c2ccc3ccccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H21NO3/c1-25-21-11-18(12-22(26-2)23(21)27-3)20-14-24-13-19(20)17-9-8-15-6-4-5-7-16(15)10-17/h4-14,24H,1-3H3 |
| InChIKey | XESSHYQCWKVIMK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole?
The IUPAC name of 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole (CID 162673848) is 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole.
What is the SMILES notation for 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole?
The canonical SMILES for 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole is COc1cc(-c2c[nH]cc2-c2ccc3ccccc3c2)cc(OC)c1OC.
What is the InChIKey of 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole?
The InChIKey is XESSHYQCWKVIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO3/c1-25-21-11-18(12-22(26-2)23(21)27-3)20-14-24-13-19(20)17-9-8-15-6-4-5-7-16(15)10-17/h4-14,24H,1-3H3.
What are the key properties of 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole?
3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole has a molecular weight of 359.43 g/mol, XLogP of 5.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-2-yl-4-(3,4,5-trimethoxyphenyl)-1H-pyrrole is sourced from PubChem (CID 162673848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).