C29H40F2N4O3 — CID 162674059
(2S)-N-[(1S)-1-[5-(3,5-difluoro-2-methoxyphenyl)-1H-imidazol-2-yl]-7-oxononyl]-6-ethyl-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 162674059) has the molecular formula C29H40F2N4O3 and a molecular weight of 530.66 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-[5-(3,5-difluoro-2-methoxyphenyl)-1H-imidazol-2-yl]-7-oxononyl]-6-ethyl-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2S)-N-[(1S)-1-[5-(3,5-difluoro-2-methoxyphenyl)-1H-imidazol-2-yl]-7-oxononyl]-6-ethyl-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 162674059 |
| Molecular Formula | C29H40F2N4O3 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | (2S)-N-[(1S)-1-[5-(3,5-difluoro-2-methoxyphenyl)-1H-imidazol-2-yl]-7-oxononyl]-6-ethyl-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)[C@H]1CC12CCN(CC)CC2)c1ncc(-c2cc(F)cc(F)c2OC)[nH]1 |
| InChI | InChI=1S/C29H40F2N4O3/c1-4-20(36)9-7-6-8-10-24(34-28(37)22-17-29(22)11-13-35(5-2)14-12-29)27-32-18-25(33-27)21-15-19(30)16-23(31)26(21)38-3/h15-16,18,22,24H,4-14,17H2,1-3H3,(H,32,33)(H,34,37)/t22-,24+/m1/s1 |
| InChIKey | KMKZXUFHLBKPAD-VWNXMTODSA-N |
| XLogP | 5.57 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|