C30H38N8O2S — CID 162674150
N-[2-(dimethylamino)-5-[[11-[3-(4-methylpiperazin-1-yl)propyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]phenyl]furan-2-carboxamide (PubChem CID 162674150) has the molecular formula C30H38N8O2S and a molecular weight of 574.76 g/mol. Its IUPAC name is N-[2-(dimethylamino)-5-[[11-[3-(4-methylpiperazin-1-yl)propyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)-5-[[11-[3-(4-methylpiperazin-1-yl)propyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 162674150 |
| Molecular Formula | C30H38N8O2S |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | N-[2-(dimethylamino)-5-[[11-[3-(4-methylpiperazin-1-yl)propyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]phenyl]furan-2-carboxamide |
| SMILES | CN1CCN(CCCN2CCc3c(sc4ncnc(Nc5ccc(N(C)C)c(NC(=O)c6ccco6)c5)c34)C2)CC1 |
| InChI | InChI=1S/C30H38N8O2S/c1-35(2)24-8-7-21(18-23(24)34-29(39)25-6-4-17-40-25)33-28-27-22-9-12-38(19-26(22)41-30(27)32-20-31-28)11-5-10-37-15-13-36(3)14-16-37/h4,6-8,17-18,20H,5,9-16,19H2,1-3H3,(H,34,39)(H,31,32,33) |
| InChIKey | GYOUQTXEVOTMGC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|