C12H13ClN6S — CID 162674166
[(E)-1-[1-(4-chlorophenyl)-5-methyltriazol-4-yl]ethylideneamino]thiourea (PubChem CID 162674166) has the molecular formula C12H13ClN6S and a molecular weight of 308.80 g/mol. Its IUPAC name is [(E)-1-[1-(4-chlorophenyl)-5-methyltriazol-4-yl]ethylideneamino]thiourea.
| Compound Name | [(E)-1-[1-(4-chlorophenyl)-5-methyltriazol-4-yl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 162674166 |
| Molecular Formula | C12H13ClN6S |
| Molecular Weight | 308.80 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | [(E)-1-[1-(4-chlorophenyl)-5-methyltriazol-4-yl]ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(N)=S)c1nnn(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C12H13ClN6S/c1-7(15-17-12(14)20)11-8(2)19(18-16-11)10-5-3-9(13)4-6-10/h3-6H,1-2H3,(H3,14,17,20)/b15-7+ |
| InChIKey | QPJCESIQPGMTNL-VIZOYTHASA-N |
| XLogP | 1.79 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.80 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|