C19H16Cl2N2O2 — CID 162674215
(1R,3S)-1-(2,4-dichlorophenyl)-3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 162674215) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is (1R,3S)-1-(2,4-dichlorophenyl)-3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (1R,3S)-1-(2,4-dichlorophenyl)-3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 162674215 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (1R,3S)-1-(2,4-dichlorophenyl)-3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | C[C@@]1(C(=O)O)Cc2c([nH]c3ccccc23)[C@@H](c2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-19(18(24)25)9-13-11-4-2-3-5-15(11)22-16(13)17(23-19)12-7-6-10(20)8-14(12)21/h2-8,17,22-23H,9H2,1H3,(H,24,25)/t17-,19+/m1/s1 |
| InChIKey | VMMICTYCEOPRSD-MJGOQNOKSA-N |
| XLogP | 4.55 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|