C22H20F2N6O2 — CID 162674381
1-[5-[[(1R)-1-(2,5-difluorophenyl)ethyl]-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]-3-(4-hydroxyphenyl)urea (PubChem CID 162674381) has the molecular formula C22H20F2N6O2 and a molecular weight of 438.44 g/mol. Its IUPAC name is 1-[5-[[(1R)-1-(2,5-difluorophenyl)ethyl]-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-[5-[[(1R)-1-(2,5-difluorophenyl)ethyl]-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 162674381 |
| Molecular Formula | C22H20F2N6O2 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-[5-[[(1R)-1-(2,5-difluorophenyl)ethyl]-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]-3-(4-hydroxyphenyl)urea |
| SMILES | C[C@H](c1cc(F)ccc1F)N(C)c1ccn2ncc(NC(=O)Nc3ccc(O)cc3)c2n1 |
| InChI | InChI=1S/C22H20F2N6O2/c1-13(17-11-14(23)3-8-18(17)24)29(2)20-9-10-30-21(28-20)19(12-25-30)27-22(32)26-15-4-6-16(31)7-5-15/h3-13,31H,1-2H3,(H2,26,27,32)/t13-/m1/s1 |
| InChIKey | STZNSTWBJYAKHQ-CYBMUJFWSA-N |
| XLogP | 4.55 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|