About ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate
ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate (PubChem CID 162674389) has the molecular formula C10H11N3O3SSe
and a molecular weight of 332.24 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate |
| PubChem CID | 162674389 |
| Molecular Formula | C10H11N3O3SSe |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(/N=C2\NC(=O)C[Se]2)nc1C |
| InChI | InChI=1S/C10H11N3O3SSe/c1-3-16-8(15)7-5(2)11-9(17-7)13-10-12-6(14)4-18-10/h3-4H2,1-2H3,(H,11,12,13,14) |
| InChIKey | SNGGXXGEVZWGEV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate (CID 162674389) is ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(/N=C2\NC(=O)C[Se]2)nc1C.
What is the InChIKey of ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate?
The InChIKey is SNGGXXGEVZWGEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O3SSe/c1-3-16-8(15)7-5(2)11-9(17-7)13-10-12-6(14)4-18-10/h3-4H2,1-2H3,(H,11,12,13,14).
What are the key properties of ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate?
ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate has a molecular weight of 332.24 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methyl-2-[(E)-(4-oxo-1,3-selenazolidin-2-ylidene)amino]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 162674389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).