C30H28O6 — CID 162674478
[(2R)-2-[(2S,3R)-6-oxo-3-phenylmethoxy-2,3-dihydropyran-2-yl]-2-phenylmethoxyethyl] (E)-3-phenylprop-2-enoate (PubChem CID 162674478) has the molecular formula C30H28O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is [(2R)-2-[(2S,3R)-6-oxo-3-phenylmethoxy-2,3-dihydropyran-2-yl]-2-phenylmethoxyethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R)-2-[(2S,3R)-6-oxo-3-phenylmethoxy-2,3-dihydropyran-2-yl]-2-phenylmethoxyethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162674478 |
| Molecular Formula | C30H28O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [(2R)-2-[(2S,3R)-6-oxo-3-phenylmethoxy-2,3-dihydropyran-2-yl]-2-phenylmethoxyethyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C1C=C[C@@H](OCc2ccccc2)[C@@H]([C@@H](COC(=O)/C=C/c2ccccc2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C30H28O6/c31-28(18-16-23-10-4-1-5-11-23)35-22-27(34-21-25-14-8-3-9-15-25)30-26(17-19-29(32)36-30)33-20-24-12-6-2-7-13-24/h1-19,26-27,30H,20-22H2/b18-16+/t26-,27-,30+/m1/s1 |
| InChIKey | JDCBNEBBNXSOHP-NMAMXUHWSA-N |
| XLogP | 4.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|