C31H31N5O2S2 — CID 162674495
N-[(1S)-5-[(2-ethylsulfanylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide (PubChem CID 162674495) has the molecular formula C31H31N5O2S2 and a molecular weight of 569.76 g/mol. Its IUPAC name is N-[(1S)-5-[(2-ethylsulfanylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-5-[(2-ethylsulfanylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 162674495 |
| Molecular Formula | C31H31N5O2S2 |
| Molecular Weight | 569.76 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | N-[(1S)-5-[(2-ethylsulfanylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCSc1ccccc1C(=O)NCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C31H31N5O2S2/c1-2-39-27-13-6-5-11-24(27)30(37)33-16-8-7-12-25(36-31(38)28-19-32-20-40-28)29-34-18-26(35-29)23-15-14-21-9-3-4-10-22(21)17-23/h3-6,9-11,13-15,17-20,25H,2,7-8,12,16H2,1H3,(H,33,37)(H,34,35)(H,36,38)/t25-/m0/s1 |
| InChIKey | UJBQYYTUWOLPJN-VWLOTQADSA-N |
| XLogP | 6.87 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.76 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|