C20H24ClN3 — CID 162674520
1-pentyl-4-(4-phenylphenyl)imidazol-2-amine;hydrochloride (PubChem CID 162674520) has the molecular formula C20H24ClN3 and a molecular weight of 341.89 g/mol. Its IUPAC name is 1-pentyl-4-(4-phenylphenyl)imidazol-2-amine;hydrochloride.
| Compound Name | 1-pentyl-4-(4-phenylphenyl)imidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 162674520 |
| Molecular Formula | C20H24ClN3 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-pentyl-4-(4-phenylphenyl)imidazol-2-amine;hydrochloride |
| SMILES | CCCCCn1cc(-c2ccc(-c3ccccc3)cc2)nc1N.Cl |
| InChI | InChI=1S/C20H23N3.ClH/c1-2-3-7-14-23-15-19(22-20(23)21)18-12-10-17(11-13-18)16-8-5-4-6-9-16;/h4-6,8-13,15H,2-3,7,14H2,1H3,(H2,21,22);1H |
| InChIKey | OVYOZZPFSJQGGV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|