C17H20ClN5O — CID 162674647
2-chloro-1-[2,4-diamino-6-(2-phenylethyl)-7,8-dihydro-6H-pyrido[3,2-d]pyrimidin-5-yl]ethanone (PubChem CID 162674647) has the molecular formula C17H20ClN5O and a molecular weight of 345.83 g/mol. Its IUPAC name is 2-chloro-1-[2,4-diamino-6-(2-phenylethyl)-7,8-dihydro-6H-pyrido[3,2-d]pyrimidin-5-yl]ethanone.
| Compound Name | 2-chloro-1-[2,4-diamino-6-(2-phenylethyl)-7,8-dihydro-6H-pyrido[3,2-d]pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 162674647 |
| Molecular Formula | C17H20ClN5O |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-chloro-1-[2,4-diamino-6-(2-phenylethyl)-7,8-dihydro-6H-pyrido[3,2-d]pyrimidin-5-yl]ethanone |
| SMILES | Nc1nc(N)c2c(n1)CCC(CCc1ccccc1)N2C(=O)CCl |
| InChI | InChI=1S/C17H20ClN5O/c18-10-14(24)23-12(7-6-11-4-2-1-3-5-11)8-9-13-15(23)16(19)22-17(20)21-13/h1-5,12H,6-10H2,(H4,19,20,21,22) |
| InChIKey | WYBGQPJOXCYVDV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|