C31H33BrN2O — CID 162674701
2-(4-bromophenyl)-7,7-dimethyl-1-phenyl-3-(4-propan-2-ylphenyl)-2,4,6,8-tetrahydroquinazolin-5-one (PubChem CID 162674701) has the molecular formula C31H33BrN2O and a molecular weight of 529.52 g/mol. Its IUPAC name is 2-(4-bromophenyl)-7,7-dimethyl-1-phenyl-3-(4-propan-2-ylphenyl)-2,4,6,8-tetrahydroquinazolin-5-one.
| Compound Name | 2-(4-bromophenyl)-7,7-dimethyl-1-phenyl-3-(4-propan-2-ylphenyl)-2,4,6,8-tetrahydroquinazolin-5-one |
|---|---|
| PubChem CID | 162674701 |
| Molecular Formula | C31H33BrN2O |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-(4-bromophenyl)-7,7-dimethyl-1-phenyl-3-(4-propan-2-ylphenyl)-2,4,6,8-tetrahydroquinazolin-5-one |
| SMILES | CC(C)c1ccc(N2CC3=C(CC(C)(C)CC3=O)N(c3ccccc3)C2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C31H33BrN2O/c1-21(2)22-12-16-25(17-13-22)33-20-27-28(18-31(3,4)19-29(27)35)34(26-8-6-5-7-9-26)30(33)23-10-14-24(32)15-11-23/h5-17,21,30H,18-20H2,1-4H3 |
| InChIKey | IHQBXKJUPFMNMQ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|