C16H14BF3O3S — CID 162674762
(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-[4-(2,2,2-trifluoroethylsulfanyl)phenyl]methanol (PubChem CID 162674762) has the molecular formula C16H14BF3O3S and a molecular weight of 354.16 g/mol. Its IUPAC name is (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-[4-(2,2,2-trifluoroethylsulfanyl)phenyl]methanol.
| Compound Name | (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-[4-(2,2,2-trifluoroethylsulfanyl)phenyl]methanol |
|---|---|
| PubChem CID | 162674762 |
| Molecular Formula | C16H14BF3O3S |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (1-hydroxy-3H-2,1-benzoxaborol-6-yl)-[4-(2,2,2-trifluoroethylsulfanyl)phenyl]methanol |
| SMILES | OB1OCc2ccc(C(O)c3ccc(SCC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C16H14BF3O3S/c18-16(19,20)9-24-13-5-3-10(4-6-13)15(21)11-1-2-12-8-23-17(22)14(12)7-11/h1-7,15,21-22H,8-9H2 |
| InChIKey | SXHLNKGSCSRLHV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|