C27H26ClN5O2 — CID 162674796
(3aS,6aS)-1-[[3-(4-chlorophenoxy)phenyl]methyl]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide (PubChem CID 162674796) has the molecular formula C27H26ClN5O2 and a molecular weight of 487.99 g/mol. Its IUPAC name is (3aS,6aS)-1-[[3-(4-chlorophenoxy)phenyl]methyl]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aS)-1-[[3-(4-chlorophenoxy)phenyl]methyl]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 162674796 |
| Molecular Formula | C27H26ClN5O2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | (3aS,6aS)-1-[[3-(4-chlorophenoxy)phenyl]methyl]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
| SMILES | O=C(Nc1cnc2[nH]ccc2c1)N1C[C@@H]2CCN(Cc3cccc(Oc4ccc(Cl)cc4)c3)[C@@H]2C1 |
| InChI | InChI=1S/C27H26ClN5O2/c28-21-4-6-23(7-5-21)35-24-3-1-2-18(12-24)15-32-11-9-20-16-33(17-25(20)32)27(34)31-22-13-19-8-10-29-26(19)30-14-22/h1-8,10,12-14,20,25H,9,11,15-17H2,(H,29,30)(H,31,34)/t20-,25+/m0/s1 |
| InChIKey | QOBTZUHQCVTKEO-NBGIEHNGSA-N |
| XLogP | 5.75 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |