C20H21FN6O — CID 162675002
(5R,14R)-8-fluoro-14-methyl-2,10,15,19,20,23-hexazapentacyclo[15.5.2.12,5.06,11.020,24]pentacosa-1(23),6(11),7,9,17(24),18,21-heptaen-16-one (PubChem CID 162675002) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is (5R,14R)-8-fluoro-14-methyl-2,10,15,19,20,23-hexazapentacyclo[15.5.2.12,5.06,11.020,24]pentacosa-1(23),6(11),7,9,17(24),18,21-heptaen-16-one.
| Compound Name | (5R,14R)-8-fluoro-14-methyl-2,10,15,19,20,23-hexazapentacyclo[15.5.2.12,5.06,11.020,24]pentacosa-1(23),6(11),7,9,17(24),18,21-heptaen-16-one |
|---|---|
| PubChem CID | 162675002 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (5R,14R)-8-fluoro-14-methyl-2,10,15,19,20,23-hexazapentacyclo[15.5.2.12,5.06,11.020,24]pentacosa-1(23),6(11),7,9,17(24),18,21-heptaen-16-one |
| SMILES | C[C@@H]1CCc2ncc(F)cc2[C@H]2CCN(C2)c2ccn3ncc(c3n2)C(=O)N1 |
| InChI | InChI=1S/C20H21FN6O/c1-12-2-3-17-15(8-14(21)9-22-17)13-4-6-26(11-13)18-5-7-27-19(25-18)16(10-23-27)20(28)24-12/h5,7-10,12-13H,2-4,6,11H2,1H3,(H,24,28)/t12-,13+/m1/s1 |
| InChIKey | QMVJRTDVKFVROZ-OLZOCXBDSA-N |
| XLogP | 2.32 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |