About 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid
4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid (PubChem CID 162675051) has the molecular formula C25H32N2O2
and a molecular weight of 392.54 g/mol. Its IUPAC name is 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid |
| PubChem CID | 162675051 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCCN2CCC(CN[C@H]3C[C@@H]3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H32N2O2/c28-25(29)22-10-8-19(9-11-22)5-4-14-27-15-12-20(13-16-27)18-26-24-17-23(24)21-6-2-1-3-7-21/h1-3,6-11,20,23-24,26H,4-5,12-18H2,(H,28,29)/t23-,24+/m1/s1 |
| InChIKey | QGKFHPFIZYWPOI-RPWUZVMVSA-N |
| XLogP | 4.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid?
The IUPAC name of 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid (CID 162675051) is 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid.
What is the SMILES notation for 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid?
The canonical SMILES for 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid is O=C(O)c1ccc(CCCN2CCC(CN[C@H]3C[C@@H]3c3ccccc3)CC2)cc1.
What is the InChIKey of 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid?
The InChIKey is QGKFHPFIZYWPOI-RPWUZVMVSA-N. The full InChI is InChI=1S/C25H32N2O2/c28-25(29)22-10-8-19(9-11-22)5-4-14-27-15-12-20(13-16-27)18-26-24-17-23(24)21-6-2-1-3-7-21/h1-3,6-11,20,23-24,26H,4-5,12-18H2,(H,28,29)/t23-,24+/m1/s1.
What are the key properties of 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid?
4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid has a molecular weight of 392.54 g/mol, XLogP of 4.18, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]benzoic acid is sourced from PubChem (CID 162675051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).