C29H21BrN2O8 — CID 162675054
diethyl 1-(4-bromophenyl)-3-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)pyrazole-4,5-dicarboxylate (PubChem CID 162675054) has the molecular formula C29H21BrN2O8 and a molecular weight of 605.40 g/mol. Its IUPAC name is diethyl 1-(4-bromophenyl)-3-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)pyrazole-4,5-dicarboxylate.
| Compound Name | diethyl 1-(4-bromophenyl)-3-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)pyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 162675054 |
| Molecular Formula | C29H21BrN2O8 |
| Molecular Weight | 605.40 g/mol |
| Exact Mass | 604.05 |
| IUPAC Name | diethyl 1-(4-bromophenyl)-3-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)pyrazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(-c2cc(O)c3c(c2)C(=O)c2cccc(O)c2C3=O)nn(-c2ccc(Br)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C29H21BrN2O8/c1-3-39-28(37)23-24(31-32(25(23)29(38)40-4-2)16-10-8-15(30)9-11-16)14-12-18-22(20(34)13-14)27(36)21-17(26(18)35)6-5-7-19(21)33/h5-13,33-34H,3-4H2,1-2H3 |
| InChIKey | XRWPNKPWZXXGAQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|