C28H38O12 — CID 162675114
[(1S,2S,3S,4R,7S,8Z,10R,12S,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-9-(hydroxymethyl)-4,13-dimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate (PubChem CID 162675114) has the molecular formula C28H38O12 and a molecular weight of 566.60 g/mol. Its IUPAC name is [(1S,2S,3S,4R,7S,8Z,10R,12S,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-9-(hydroxymethyl)-4,13-dimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate.
| Compound Name | [(1S,2S,3S,4R,7S,8Z,10R,12S,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-9-(hydroxymethyl)-4,13-dimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate |
|---|---|
| PubChem CID | 162675114 |
| Molecular Formula | C28H38O12 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | [(1S,2S,3S,4R,7S,8Z,10R,12S,13R,14S)-2,10,12-triacetyloxy-3-hydroxy-9-(hydroxymethyl)-4,13-dimethyl-17-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate |
| SMILES | C=C1CC[C@H](OC(C)=O)[C@]2(C)[C@@H](OC(C)=O)C[C@@H](OC(C)=O)/C(CO)=C\[C@@H]3OC(=O)[C@H](C)[C@@]3(O)[C@@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C28H38O12/c1-13-8-9-21(37-16(4)31)27(7)22(38-17(5)32)11-20(36-15(3)30)19(12-29)10-23-28(35,14(2)26(34)40-23)25(24(13)27)39-18(6)33/h10,14,20-25,29,35H,1,8-9,11-12H2,2-7H3/b19-10-/t14-,20+,21-,22-,23-,24+,25-,27+,28-/m0/s1 |
| InChIKey | OKUVXDPKJLWOCM-JKRPSWISSA-N |
| XLogP | 1.30 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|