C28H27N7O — CID 162675205
1-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 162675205) has the molecular formula C28H27N7O and a molecular weight of 477.57 g/mol. Its IUPAC name is 1-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 162675205 |
| Molecular Formula | C28H27N7O |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 1-[3-[[7-(1-methylpyrazol-4-yl)quinazolin-4-yl]amino]phenyl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)Nc2cccc(Nc3ncnc4cc(-c5cnn(C)c5)ccc34)c2)cc1 |
| InChI | InChI=1S/C28H27N7O/c1-18(2)19-7-10-22(11-8-19)33-28(36)34-24-6-4-5-23(14-24)32-27-25-12-9-20(13-26(25)29-17-30-27)21-15-31-35(3)16-21/h4-18H,1-3H3,(H,29,30,32)(H2,33,34,36) |
| InChIKey | AUEWHFRAYMYFLU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |