C15H27N3O3 — CID 162675348
3-imidazol-1-yl-N-[[(3R,4R)-3-methoxy-3,6,6-trimethyldioxan-4-yl]methyl]propan-1-amine (PubChem CID 162675348) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[[(3R,4R)-3-methoxy-3,6,6-trimethyldioxan-4-yl]methyl]propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-[[(3R,4R)-3-methoxy-3,6,6-trimethyldioxan-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 162675348 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 3-imidazol-1-yl-N-[[(3R,4R)-3-methoxy-3,6,6-trimethyldioxan-4-yl]methyl]propan-1-amine |
| SMILES | CO[C@]1(C)OOC(C)(C)C[C@@H]1CNCCCn1ccnc1 |
| InChI | InChI=1S/C15H27N3O3/c1-14(2)10-13(15(3,19-4)21-20-14)11-16-6-5-8-18-9-7-17-12-18/h7,9,12-13,16H,5-6,8,10-11H2,1-4H3/t13-,15-/m1/s1 |
| InChIKey | JYAIVGPSJFTLSH-UKRRQHHQSA-N |
| XLogP | 1.97 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|