About 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline
3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline (PubChem CID 162675423) has the molecular formula C31H34N2O4
and a molecular weight of 498.62 g/mol. Its IUPAC name is 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline.
Molecular Properties
| Compound Name | 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline |
| PubChem CID | 162675423 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline |
| SMILES | COc1ccc(CCCNCc2c(OC)cc(Oc3cccc(Nc4ccccc4)c3)cc2OC)cc1 |
| InChI | InChI=1S/C31H34N2O4/c1-34-26-16-14-23(15-17-26)9-8-18-32-22-29-30(35-2)20-28(21-31(29)36-3)37-27-13-7-12-25(19-27)33-24-10-5-4-6-11-24/h4-7,10-17,19-21,32-33H,8-9,18,22H2,1-3H3 |
| InChIKey | XRCDNYXFMPXULT-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline?
The IUPAC name of 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline (CID 162675423) is 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline.
What is the SMILES notation for 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline?
The canonical SMILES for 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline is COc1ccc(CCCNCc2c(OC)cc(Oc3cccc(Nc4ccccc4)c3)cc2OC)cc1.
What is the InChIKey of 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline?
The InChIKey is XRCDNYXFMPXULT-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H34N2O4/c1-34-26-16-14-23(15-17-26)9-8-18-32-22-29-30(35-2)20-28(21-31(29)36-3)37-27-13-7-12-25(19-27)33-24-10-5-4-6-11-24/h4-7,10-17,19-21,32-33H,8-9,18,22H2,1-3H3.
What are the key properties of 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline?
3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline has a molecular weight of 498.62 g/mol, XLogP of 6.97, 13 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dimethoxy-4-[[3-(4-methoxyphenyl)propylamino]methyl]phenoxy]-N-phenylaniline is sourced from PubChem (CID 162675423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).