About 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide
6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide (PubChem CID 162675433) has the molecular formula C14H11NO4S
and a molecular weight of 289.31 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide.
Molecular Properties
| Compound Name | 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide |
| PubChem CID | 162675433 |
| Molecular Formula | C14H11NO4S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide |
| SMILES | COc1cccc(-c2cnc3c(c2)C=CS(=O)(=O)O3)c1 |
| InChI | InChI=1S/C14H11NO4S/c1-18-13-4-2-3-10(8-13)12-7-11-5-6-20(16,17)19-14(11)15-9-12/h2-9H,1H3 |
| InChIKey | KXASSMVTZKGURM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide?
The IUPAC name of 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide (CID 162675433) is 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide.
What is the SMILES notation for 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide?
The canonical SMILES for 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide is COc1cccc(-c2cnc3c(c2)C=CS(=O)(=O)O3)c1.
What is the InChIKey of 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide?
The InChIKey is KXASSMVTZKGURM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO4S/c1-18-13-4-2-3-10(8-13)12-7-11-5-6-20(16,17)19-14(11)15-9-12/h2-9H,1H3.
What are the key properties of 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide?
6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide has a molecular weight of 289.31 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methoxyphenyl)oxathiino[6,5-b]pyridine 2,2-dioxide is sourced from PubChem (CID 162675433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).