About (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate
(5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate (PubChem CID 162675454) has the molecular formula C17H16O6
and a molecular weight of 316.31 g/mol. Its IUPAC name is (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate.
Molecular Properties
| Compound Name | (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate |
| PubChem CID | 162675454 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate |
| SMILES | CC(=O)OCC1=CCc2c(cc3oc(C)cc(=O)c3c2O)OC1 |
| InChI | InChI=1S/C17H16O6/c1-9-5-13(19)16-15(23-9)6-14-12(17(16)20)4-3-11(8-22-14)7-21-10(2)18/h3,5-6,20H,4,7-8H2,1-2H3 |
| InChIKey | MJJPDVCYFCKGNZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate?
The IUPAC name of (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate (CID 162675454) is (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate.
What is the SMILES notation for (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate?
The canonical SMILES for (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate is CC(=O)OCC1=CCc2c(cc3oc(C)cc(=O)c3c2O)OC1.
What is the InChIKey of (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate?
The InChIKey is MJJPDVCYFCKGNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O6/c1-9-5-13(19)16-15(23-9)6-14-12(17(16)20)4-3-11(8-22-14)7-21-10(2)18/h3,5-6,20H,4,7-8H2,1-2H3.
What are the key properties of (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate?
(5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate has a molecular weight of 316.31 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-2-methyl-4-oxo-6,9-dihydropyrano[3,2-h][1]benzoxepin-8-yl)methyl acetate is sourced from PubChem (CID 162675454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).