C22H30N4O2S — CID 162675460
N-hydroxy-2-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]-1,3-thiazole-5-carboxamide (PubChem CID 162675460) has the molecular formula C22H30N4O2S and a molecular weight of 414.58 g/mol. Its IUPAC name is N-hydroxy-2-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-hydroxy-2-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 162675460 |
| Molecular Formula | C22H30N4O2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-hydroxy-2-[3-[4-[[[(1S,2R)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]propyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NO)c1cnc(CCCN2CCC(CN[C@H]3C[C@@H]3c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C22H30N4O2S/c27-22(25-28)20-15-24-21(29-20)7-4-10-26-11-8-16(9-12-26)14-23-19-13-18(19)17-5-2-1-3-6-17/h1-3,5-6,15-16,18-19,23,28H,4,7-14H2,(H,25,27)/t18-,19+/m1/s1 |
| InChIKey | JZVXHLNIORJHPD-MOPGFXCFSA-N |
| XLogP | 3.05 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|